C14H10F8N2O2 — CID 19373678
3-[4-(2,2,3,3,4,4,5,5-octafluoropentoxy)phenyl]-1H-imidazol-2-one (PubChem CID 19373678) has the molecular formula C14H10F8N2O2 and a molecular weight of 390.23 g/mol. Its IUPAC name is 3-[4-(2,2,3,3,4,4,5,5-octafluoropentoxy)phenyl]-1H-imidazol-2-one.
| Compound Name | 3-[4-(2,2,3,3,4,4,5,5-octafluoropentoxy)phenyl]-1H-imidazol-2-one |
|---|---|
| PubChem CID | 19373678 |
| Molecular Formula | C14H10F8N2O2 |
| Molecular Weight | 390.23 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 3-[4-(2,2,3,3,4,4,5,5-octafluoropentoxy)phenyl]-1H-imidazol-2-one |
| SMILES | O=c1[nH]ccn1-c1ccc(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C14H10F8N2O2/c15-10(16)13(19,20)14(21,22)12(17,18)7-26-9-3-1-8(2-4-9)24-6-5-23-11(24)25/h1-6,10H,7H2,(H,23,25) |
| InChIKey | GMBYGRUPWPSDTC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.23 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|