About 4-(3-methylbutyl)-1H-1,2,4-triazol-5-one
4-(3-methylbutyl)-1H-1,2,4-triazol-5-one (PubChem CID 19373684) has the molecular formula C7H13N3O
and a molecular weight of 155.20 g/mol. Its IUPAC name is 4-(3-methylbutyl)-1H-1,2,4-triazol-5-one.
Molecular Properties
| Compound Name | 4-(3-methylbutyl)-1H-1,2,4-triazol-5-one |
| PubChem CID | 19373684 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 4-(3-methylbutyl)-1H-1,2,4-triazol-5-one |
| SMILES | CC(C)CCn1cn[nH]c1=O |
| InChI | InChI=1S/C7H13N3O/c1-6(2)3-4-10-5-8-9-7(10)11/h5-6H,3-4H2,1-2H3,(H,9,11) |
| InChIKey | OZTUXHLUBCCDAV-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3-methylbutyl)-1H-1,2,4-triazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methylbutyl)-1H-1,2,4-triazol-5-one?
The IUPAC name of 4-(3-methylbutyl)-1H-1,2,4-triazol-5-one (CID 19373684) is 4-(3-methylbutyl)-1H-1,2,4-triazol-5-one.
What is the SMILES notation for 4-(3-methylbutyl)-1H-1,2,4-triazol-5-one?
The canonical SMILES for 4-(3-methylbutyl)-1H-1,2,4-triazol-5-one is CC(C)CCn1cn[nH]c1=O.
What is the InChIKey of 4-(3-methylbutyl)-1H-1,2,4-triazol-5-one?
The InChIKey is OZTUXHLUBCCDAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O/c1-6(2)3-4-10-5-8-9-7(10)11/h5-6H,3-4H2,1-2H3,(H,9,11).
What are the key properties of 4-(3-methylbutyl)-1H-1,2,4-triazol-5-one?
4-(3-methylbutyl)-1H-1,2,4-triazol-5-one has a molecular weight of 155.20 g/mol, XLogP of 0.62, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methylbutyl)-1H-1,2,4-triazol-5-one is sourced from PubChem (CID 19373684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).