C40H86O9Si4 — CID 19373868
[4-[[decyl(dimethyl)silyl]oxy-dimethylsilyl]-2,3-dihydroxyhexanoyl] 4-[[decyl(dimethyl)silyl]oxy-dimethylsilyl]-2,3-dihydroxyhexanoate (PubChem CID 19373868) has the molecular formula C40H86O9Si4 and a molecular weight of 823.46 g/mol. Its IUPAC name is [4-[[decyl(dimethyl)silyl]oxy-dimethylsilyl]-2,3-dihydroxyhexanoyl] 4-[[decyl(dimethyl)silyl]oxy-dimethylsilyl]-2,3-dihydroxyhexanoate.
| Compound Name | [4-[[decyl(dimethyl)silyl]oxy-dimethylsilyl]-2,3-dihydroxyhexanoyl] 4-[[decyl(dimethyl)silyl]oxy-dimethylsilyl]-2,3-dihydroxyhexanoate |
|---|---|
| PubChem CID | 19373868 |
| Molecular Formula | C40H86O9Si4 |
| Molecular Weight | 823.46 g/mol |
| Exact Mass | 822.53 |
| IUPAC Name | [4-[[decyl(dimethyl)silyl]oxy-dimethylsilyl]-2,3-dihydroxyhexanoyl] 4-[[decyl(dimethyl)silyl]oxy-dimethylsilyl]-2,3-dihydroxyhexanoate |
| SMILES | CCCCCCCCCC[Si](C)(C)O[Si](C)(C)C(CC)C(O)C(O)C(=O)OC(=O)C(O)C(O)C(CC)[Si](C)(C)O[Si](C)(C)CCCCCCCCCC |
| InChI | InChI=1S/C40H86O9Si4/c1-13-17-19-21-23-25-27-29-31-50(5,6)48-52(9,10)33(15-3)35(41)37(43)39(45)47-40(46)38(44)36(42)34(16-4)53(11,12)49-51(7,8)32-30-28-26-24-22-20-18-14-2/h33-38,41-44H,13-32H2,1-12H3 |
| InChIKey | SLWCKKPSUUSKAS-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.46 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|