About ethyl 6-ethoxy-4-oxo-1H-1,8-naphthyridine-3-carboxylate;dihydrate
ethyl 6-ethoxy-4-oxo-1H-1,8-naphthyridine-3-carboxylate;dihydrate (PubChem CID 19374332) has the molecular formula C13H18N2O6
and a molecular weight of 298.30 g/mol. Its IUPAC name is ethyl 6-ethoxy-4-oxo-1H-1,8-naphthyridine-3-carboxylate;dihydrate.
Molecular Properties
| Compound Name | ethyl 6-ethoxy-4-oxo-1H-1,8-naphthyridine-3-carboxylate;dihydrate |
| PubChem CID | 19374332 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | ethyl 6-ethoxy-4-oxo-1H-1,8-naphthyridine-3-carboxylate;dihydrate |
| SMILES | CCOC(=O)c1c[nH]c2ncc(OCC)cc2c1=O.O.O |
| InChI | InChI=1S/C13H14N2O4.2H2O/c1-3-18-8-5-9-11(16)10(13(17)19-4-2)7-15-12(9)14-6-8;;/h5-7H,3-4H2,1-2H3,(H,14,15,16);2*1H2 |
| InChIKey | KOGBOTNOPOSDDT-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 144.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 6-ethoxy-4-oxo-1H-1,8-naphthyridine-3-carboxylate;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-ethoxy-4-oxo-1H-1,8-naphthyridine-3-carboxylate;dihydrate?
The IUPAC name of ethyl 6-ethoxy-4-oxo-1H-1,8-naphthyridine-3-carboxylate;dihydrate (CID 19374332) is ethyl 6-ethoxy-4-oxo-1H-1,8-naphthyridine-3-carboxylate;dihydrate.
What is the SMILES notation for ethyl 6-ethoxy-4-oxo-1H-1,8-naphthyridine-3-carboxylate;dihydrate?
The canonical SMILES for ethyl 6-ethoxy-4-oxo-1H-1,8-naphthyridine-3-carboxylate;dihydrate is CCOC(=O)c1c[nH]c2ncc(OCC)cc2c1=O.O.O.
What is the InChIKey of ethyl 6-ethoxy-4-oxo-1H-1,8-naphthyridine-3-carboxylate;dihydrate?
The InChIKey is KOGBOTNOPOSDDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O4.2H2O/c1-3-18-8-5-9-11(16)10(13(17)19-4-2)7-15-12(9)14-6-8;;/h5-7H,3-4H2,1-2H3,(H,14,15,16);2*1H2.
What are the key properties of ethyl 6-ethoxy-4-oxo-1H-1,8-naphthyridine-3-carboxylate;dihydrate?
ethyl 6-ethoxy-4-oxo-1H-1,8-naphthyridine-3-carboxylate;dihydrate has a molecular weight of 298.30 g/mol, XLogP of -0.15, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-ethoxy-4-oxo-1H-1,8-naphthyridine-3-carboxylate;dihydrate is sourced from PubChem (CID 19374332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).