C14H11BrF4O4 — CID 19374401
ethyl (Z)-2-(2-bromo-3,4,5,6-tetrafluorobenzoyl)-3-ethoxyprop-2-enoate (PubChem CID 19374401) has the molecular formula C14H11BrF4O4 and a molecular weight of 399.13 g/mol. Its IUPAC name is ethyl (Z)-2-(2-bromo-3,4,5,6-tetrafluorobenzoyl)-3-ethoxyprop-2-enoate.
| Compound Name | ethyl (Z)-2-(2-bromo-3,4,5,6-tetrafluorobenzoyl)-3-ethoxyprop-2-enoate |
|---|---|
| PubChem CID | 19374401 |
| Molecular Formula | C14H11BrF4O4 |
| Molecular Weight | 399.13 g/mol |
| Exact Mass | 397.98 |
| IUPAC Name | ethyl (Z)-2-(2-bromo-3,4,5,6-tetrafluorobenzoyl)-3-ethoxyprop-2-enoate |
| SMILES | CCO/C=C(\C(=O)OCC)C(=O)c1c(F)c(F)c(F)c(F)c1Br |
| InChI | InChI=1S/C14H11BrF4O4/c1-3-22-5-6(14(21)23-4-2)13(20)7-8(15)10(17)12(19)11(18)9(7)16/h5H,3-4H2,1-2H3/b6-5- |
| InChIKey | BHTQWJYMOPTFOV-WAYWQWQTSA-N |
| XLogP | 3.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.13 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|