2-anilino-2-phenylacetic acid

C14H13NO2 — CID 19375

IUPAC2-anilino-2-phenylacetic acid
SMILESO=C(O)C(Nc1ccccc1)c1ccccc1
InChIInChI=1S/C14H13NO2/c16-14(17)13(11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10,13,15H,(H,16,17)
InChIKeyNFEVMRNCAGDLBK-UHFFFAOYSA-N
MW227.26 g/mol
LogP2.92
Rot. Bonds4

About 2-anilino-2-phenylacetic acid

2-anilino-2-phenylacetic acid (PubChem CID 19375) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-anilino-2-phenylacetic acid.

Molecular Properties

Compound Name2-anilino-2-phenylacetic acid
PubChem CID19375
Molecular FormulaC14H13NO2
Molecular Weight227.26 g/mol
Exact Mass227.09
IUPAC Name2-anilino-2-phenylacetic acid
SMILESO=C(O)C(Nc1ccccc1)c1ccccc1
InChIInChI=1S/C14H13NO2/c16-14(17)13(11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10,13,15H,(H,16,17)
InChIKeyNFEVMRNCAGDLBK-UHFFFAOYSA-N
XLogP2.92
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.26
LogP ≤ 52.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-anilino-2-phenylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-anilino-2-phenylacetic acid?
The IUPAC name of 2-anilino-2-phenylacetic acid (CID 19375) is 2-anilino-2-phenylacetic acid.
What is the SMILES notation for 2-anilino-2-phenylacetic acid?
The canonical SMILES for 2-anilino-2-phenylacetic acid is O=C(O)C(Nc1ccccc1)c1ccccc1.
What is the InChIKey of 2-anilino-2-phenylacetic acid?
The InChIKey is NFEVMRNCAGDLBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2/c16-14(17)13(11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10,13,15H,(H,16,17).
What are the key properties of 2-anilino-2-phenylacetic acid?
2-anilino-2-phenylacetic acid has a molecular weight of 227.26 g/mol, XLogP of 2.92, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilino-2-phenylacetic acid is sourced from PubChem (CID 19375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).