C13H28O2 — CID 19375236
2,2,4,4,6,6-hexamethylheptane-3,3-diol (PubChem CID 19375236) has the molecular formula C13H28O2 and a molecular weight of 216.36 g/mol. Its IUPAC name is 2,2,4,4,6,6-hexamethylheptane-3,3-diol.
| Compound Name | 2,2,4,4,6,6-hexamethylheptane-3,3-diol |
|---|---|
| PubChem CID | 19375236 |
| Molecular Formula | C13H28O2 |
| Molecular Weight | 216.36 g/mol |
| Exact Mass | 216.21 |
| IUPAC Name | 2,2,4,4,6,6-hexamethylheptane-3,3-diol |
| SMILES | CC(C)(C)CC(C)(C)C(O)(O)C(C)(C)C |
| InChI | InChI=1S/C13H28O2/c1-10(2,3)9-12(7,8)13(14,15)11(4,5)6/h14-15H,9H2,1-8H3 |
| InChIKey | CTKQLICERBAERF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|