About 6-oxo-1,3-dihydropyridazine-2-carbonitrile
6-oxo-1,3-dihydropyridazine-2-carbonitrile (PubChem CID 19375483) has the molecular formula C5H5N3O
and a molecular weight of 123.11 g/mol. Its IUPAC name is 6-oxo-1,3-dihydropyridazine-2-carbonitrile.
Molecular Properties
| Compound Name | 6-oxo-1,3-dihydropyridazine-2-carbonitrile |
| PubChem CID | 19375483 |
| Molecular Formula | C5H5N3O |
| Molecular Weight | 123.11 g/mol |
| Exact Mass | 123.04 |
| IUPAC Name | 6-oxo-1,3-dihydropyridazine-2-carbonitrile |
| SMILES | N#CN1CC=CC(=O)N1 |
| InChI | InChI=1S/C5H5N3O/c6-4-8-3-1-2-5(9)7-8/h1-2H,3H2,(H,7,9) |
| InChIKey | YVONJAYJBRKDJI-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.11 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 6-oxo-1,3-dihydropyridazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-1,3-dihydropyridazine-2-carbonitrile?
The IUPAC name of 6-oxo-1,3-dihydropyridazine-2-carbonitrile (CID 19375483) is 6-oxo-1,3-dihydropyridazine-2-carbonitrile.
What is the SMILES notation for 6-oxo-1,3-dihydropyridazine-2-carbonitrile?
The canonical SMILES for 6-oxo-1,3-dihydropyridazine-2-carbonitrile is N#CN1CC=CC(=O)N1.
What is the InChIKey of 6-oxo-1,3-dihydropyridazine-2-carbonitrile?
The InChIKey is YVONJAYJBRKDJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O/c6-4-8-3-1-2-5(9)7-8/h1-2H,3H2,(H,7,9).
What are the key properties of 6-oxo-1,3-dihydropyridazine-2-carbonitrile?
6-oxo-1,3-dihydropyridazine-2-carbonitrile has a molecular weight of 123.11 g/mol, XLogP of -0.63, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-1,3-dihydropyridazine-2-carbonitrile is sourced from PubChem (CID 19375483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).