About 4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]-3-phenylbutan-1-amine
4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]-3-phenylbutan-1-amine (PubChem CID 19375618) has the molecular formula C22H28ClN3O2
and a molecular weight of 401.94 g/mol. Its IUPAC name is 4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]-3-phenylbutan-1-amine.
Molecular Properties
| Compound Name | 4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]-3-phenylbutan-1-amine |
| PubChem CID | 19375618 |
| Molecular Formula | C22H28ClN3O2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]-3-phenylbutan-1-amine |
| SMILES | NCCC(CN1CCN(c2cc(Cl)cc3c2OCCO3)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H28ClN3O2/c23-19-14-20(22-21(15-19)27-12-13-28-22)26-10-8-25(9-11-26)16-18(6-7-24)17-4-2-1-3-5-17/h1-5,14-15,18H,6-13,16,24H2 |
| InChIKey | NTGUIKAGLHAFPK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]-3-phenylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]-3-phenylbutan-1-amine?
The IUPAC name of 4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]-3-phenylbutan-1-amine (CID 19375618) is 4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]-3-phenylbutan-1-amine.
What is the SMILES notation for 4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]-3-phenylbutan-1-amine?
The canonical SMILES for 4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]-3-phenylbutan-1-amine is NCCC(CN1CCN(c2cc(Cl)cc3c2OCCO3)CC1)c1ccccc1.
What is the InChIKey of 4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]-3-phenylbutan-1-amine?
The InChIKey is NTGUIKAGLHAFPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28ClN3O2/c23-19-14-20(22-21(15-19)27-12-13-28-22)26-10-8-25(9-11-26)16-18(6-7-24)17-4-2-1-3-5-17/h1-5,14-15,18H,6-13,16,24H2.
What are the key properties of 4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]-3-phenylbutan-1-amine?
4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]-3-phenylbutan-1-amine has a molecular weight of 401.94 g/mol, XLogP of 3.37, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]-3-phenylbutan-1-amine is sourced from PubChem (CID 19375618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).