C24H26BrN3O4 — CID 19375652
2-[4-[4-(7-bromo-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]butyl]isoindole-1,3-dione (PubChem CID 19375652) has the molecular formula C24H26BrN3O4 and a molecular weight of 500.39 g/mol. Its IUPAC name is 2-[4-[4-(7-bromo-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[4-(7-bromo-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 19375652 |
| Molecular Formula | C24H26BrN3O4 |
| Molecular Weight | 500.39 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 2-[4-[4-(7-bromo-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]butyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCN1CCN(c2cc(Br)cc3c2OCCO3)CC1 |
| InChI | InChI=1S/C24H26BrN3O4/c25-17-15-20(22-21(16-17)31-13-14-32-22)27-11-9-26(10-12-27)7-3-4-8-28-23(29)18-5-1-2-6-19(18)24(28)30/h1-2,5-6,15-16H,3-4,7-14H2 |
| InChIKey | GECZIPWUSKDRIS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|