About [5-[3-[2-(1,3-dioxolan-2-yl)phenoxy]propoxy]-4-ethyl-2-(4-fluorophenyl)phenyl] acetate
[5-[3-[2-(1,3-dioxolan-2-yl)phenoxy]propoxy]-4-ethyl-2-(4-fluorophenyl)phenyl] acetate (PubChem CID 19375751) has the molecular formula C28H29FO6
and a molecular weight of 480.53 g/mol. Its IUPAC name is [5-[3-[2-(1,3-dioxolan-2-yl)phenoxy]propoxy]-4-ethyl-2-(4-fluorophenyl)phenyl] acetate.
Molecular Properties
| Compound Name | [5-[3-[2-(1,3-dioxolan-2-yl)phenoxy]propoxy]-4-ethyl-2-(4-fluorophenyl)phenyl] acetate |
| PubChem CID | 19375751 |
| Molecular Formula | C28H29FO6 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | [5-[3-[2-(1,3-dioxolan-2-yl)phenoxy]propoxy]-4-ethyl-2-(4-fluorophenyl)phenyl] acetate |
| SMILES | CCc1cc(-c2ccc(F)cc2)c(OC(C)=O)cc1OCCCOc1ccccc1C1OCCO1 |
| InChI | InChI=1S/C28H29FO6/c1-3-20-17-24(21-9-11-22(29)12-10-21)27(35-19(2)30)18-26(20)32-14-6-13-31-25-8-5-4-7-23(25)28-33-15-16-34-28/h4-5,7-12,17-18,28H,3,6,13-16H2,1-2H3 |
| InChIKey | OEVOAUKXWMXDLG-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [5-[3-[2-(1,3-dioxolan-2-yl)phenoxy]propoxy]-4-ethyl-2-(4-fluorophenyl)phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[3-[2-(1,3-dioxolan-2-yl)phenoxy]propoxy]-4-ethyl-2-(4-fluorophenyl)phenyl] acetate?
The IUPAC name of [5-[3-[2-(1,3-dioxolan-2-yl)phenoxy]propoxy]-4-ethyl-2-(4-fluorophenyl)phenyl] acetate (CID 19375751) is [5-[3-[2-(1,3-dioxolan-2-yl)phenoxy]propoxy]-4-ethyl-2-(4-fluorophenyl)phenyl] acetate.
What is the SMILES notation for [5-[3-[2-(1,3-dioxolan-2-yl)phenoxy]propoxy]-4-ethyl-2-(4-fluorophenyl)phenyl] acetate?
The canonical SMILES for [5-[3-[2-(1,3-dioxolan-2-yl)phenoxy]propoxy]-4-ethyl-2-(4-fluorophenyl)phenyl] acetate is CCc1cc(-c2ccc(F)cc2)c(OC(C)=O)cc1OCCCOc1ccccc1C1OCCO1.
What is the InChIKey of [5-[3-[2-(1,3-dioxolan-2-yl)phenoxy]propoxy]-4-ethyl-2-(4-fluorophenyl)phenyl] acetate?
The InChIKey is OEVOAUKXWMXDLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H29FO6/c1-3-20-17-24(21-9-11-22(29)12-10-21)27(35-19(2)30)18-26(20)32-14-6-13-31-25-8-5-4-7-23(25)28-33-15-16-34-28/h4-5,7-12,17-18,28H,3,6,13-16H2,1-2H3.
What are the key properties of [5-[3-[2-(1,3-dioxolan-2-yl)phenoxy]propoxy]-4-ethyl-2-(4-fluorophenyl)phenyl] acetate?
[5-[3-[2-(1,3-dioxolan-2-yl)phenoxy]propoxy]-4-ethyl-2-(4-fluorophenyl)phenyl] acetate has a molecular weight of 480.53 g/mol, XLogP of 5.87, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[3-[2-(1,3-dioxolan-2-yl)phenoxy]propoxy]-4-ethyl-2-(4-fluorophenyl)phenyl] acetate is sourced from PubChem (CID 19375751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).