About N-(4,4-dimethyl-5-oxopentyl)-2-methylprop-2-enamide
N-(4,4-dimethyl-5-oxopentyl)-2-methylprop-2-enamide (PubChem CID 19376149) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is N-(4,4-dimethyl-5-oxopentyl)-2-methylprop-2-enamide.
Molecular Properties
| Compound Name | N-(4,4-dimethyl-5-oxopentyl)-2-methylprop-2-enamide |
| PubChem CID | 19376149 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | N-(4,4-dimethyl-5-oxopentyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCC(C)(C)C=O |
| InChI | InChI=1S/C11H19NO2/c1-9(2)10(14)12-7-5-6-11(3,4)8-13/h8H,1,5-7H2,2-4H3,(H,12,14) |
| InChIKey | ZKSUHQIQPKKVEL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4,4-dimethyl-5-oxopentyl)-2-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-dimethyl-5-oxopentyl)-2-methylprop-2-enamide?
The IUPAC name of N-(4,4-dimethyl-5-oxopentyl)-2-methylprop-2-enamide (CID 19376149) is N-(4,4-dimethyl-5-oxopentyl)-2-methylprop-2-enamide.
What is the SMILES notation for N-(4,4-dimethyl-5-oxopentyl)-2-methylprop-2-enamide?
The canonical SMILES for N-(4,4-dimethyl-5-oxopentyl)-2-methylprop-2-enamide is C=C(C)C(=O)NCCCC(C)(C)C=O.
What is the InChIKey of N-(4,4-dimethyl-5-oxopentyl)-2-methylprop-2-enamide?
The InChIKey is ZKSUHQIQPKKVEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-9(2)10(14)12-7-5-6-11(3,4)8-13/h8H,1,5-7H2,2-4H3,(H,12,14).
What are the key properties of N-(4,4-dimethyl-5-oxopentyl)-2-methylprop-2-enamide?
N-(4,4-dimethyl-5-oxopentyl)-2-methylprop-2-enamide has a molecular weight of 197.28 g/mol, XLogP of 1.68, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-dimethyl-5-oxopentyl)-2-methylprop-2-enamide is sourced from PubChem (CID 19376149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).