About 1,1-dimethoxyethane;trichloroniobium
1,1-dimethoxyethane;trichloroniobium (PubChem CID 19377144) has the molecular formula C4H10Cl3NbO2
and a molecular weight of 289.39 g/mol. Its IUPAC name is 1,1-dimethoxyethane;trichloroniobium.
Molecular Properties
| Compound Name | 1,1-dimethoxyethane;trichloroniobium |
| PubChem CID | 19377144 |
| Molecular Formula | C4H10Cl3NbO2 |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 287.88 |
| IUPAC Name | 1,1-dimethoxyethane;trichloroniobium |
| SMILES | COC(C)OC.Cl[Nb](Cl)Cl |
| InChI | InChI=1S/C4H10O2.3ClH.Nb/c1-4(5-2)6-3;;;;/h4H,1-3H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | JHMOQPSXCPLNDH-UHFFFAOYSA-K |
| XLogP | 2.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethoxyethane;trichloroniobium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethoxyethane;trichloroniobium?
The IUPAC name of 1,1-dimethoxyethane;trichloroniobium (CID 19377144) is 1,1-dimethoxyethane;trichloroniobium.
What is the SMILES notation for 1,1-dimethoxyethane;trichloroniobium?
The canonical SMILES for 1,1-dimethoxyethane;trichloroniobium is COC(C)OC.Cl[Nb](Cl)Cl.
What is the InChIKey of 1,1-dimethoxyethane;trichloroniobium?
The InChIKey is JHMOQPSXCPLNDH-UHFFFAOYSA-K. The full InChI is InChI=1S/C4H10O2.3ClH.Nb/c1-4(5-2)6-3;;;;/h4H,1-3H3;3*1H;/q;;;;+3/p-3.
What are the key properties of 1,1-dimethoxyethane;trichloroniobium?
1,1-dimethoxyethane;trichloroniobium has a molecular weight of 289.39 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethoxyethane;trichloroniobium is sourced from PubChem (CID 19377144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).