About N-methyl-N-(4-oxo-2,3-dihydro-1H-naphthalen-1-yl)formamide
N-methyl-N-(4-oxo-2,3-dihydro-1H-naphthalen-1-yl)formamide (PubChem CID 19377150) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is N-methyl-N-(4-oxo-2,3-dihydro-1H-naphthalen-1-yl)formamide.
Molecular Properties
| Compound Name | N-methyl-N-(4-oxo-2,3-dihydro-1H-naphthalen-1-yl)formamide |
| PubChem CID | 19377150 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | N-methyl-N-(4-oxo-2,3-dihydro-1H-naphthalen-1-yl)formamide |
| SMILES | CN(C=O)C1CCC(=O)c2ccccc21 |
| InChI | InChI=1S/C12H13NO2/c1-13(8-14)11-6-7-12(15)10-5-3-2-4-9(10)11/h2-5,8,11H,6-7H2,1H3 |
| InChIKey | CAUWAAFMKRFEAG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-(4-oxo-2,3-dihydro-1H-naphthalen-1-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-(4-oxo-2,3-dihydro-1H-naphthalen-1-yl)formamide?
The IUPAC name of N-methyl-N-(4-oxo-2,3-dihydro-1H-naphthalen-1-yl)formamide (CID 19377150) is N-methyl-N-(4-oxo-2,3-dihydro-1H-naphthalen-1-yl)formamide.
What is the SMILES notation for N-methyl-N-(4-oxo-2,3-dihydro-1H-naphthalen-1-yl)formamide?
The canonical SMILES for N-methyl-N-(4-oxo-2,3-dihydro-1H-naphthalen-1-yl)formamide is CN(C=O)C1CCC(=O)c2ccccc21.
What is the InChIKey of N-methyl-N-(4-oxo-2,3-dihydro-1H-naphthalen-1-yl)formamide?
The InChIKey is CAUWAAFMKRFEAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c1-13(8-14)11-6-7-12(15)10-5-3-2-4-9(10)11/h2-5,8,11H,6-7H2,1H3.
What are the key properties of N-methyl-N-(4-oxo-2,3-dihydro-1H-naphthalen-1-yl)formamide?
N-methyl-N-(4-oxo-2,3-dihydro-1H-naphthalen-1-yl)formamide has a molecular weight of 203.24 g/mol, XLogP of 1.79, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-(4-oxo-2,3-dihydro-1H-naphthalen-1-yl)formamide is sourced from PubChem (CID 19377150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).