C14H23Cl2N5O3S — CID 19377835
4-(4-aminopiperidin-1-yl)-N-(diaminomethylidene)-3-methylsulfonylbenzamide;dihydrochloride (PubChem CID 19377835) has the molecular formula C14H23Cl2N5O3S and a molecular weight of 412.34 g/mol. Its IUPAC name is 4-(4-aminopiperidin-1-yl)-N-(diaminomethylidene)-3-methylsulfonylbenzamide;dihydrochloride.
| Compound Name | 4-(4-aminopiperidin-1-yl)-N-(diaminomethylidene)-3-methylsulfonylbenzamide;dihydrochloride |
|---|---|
| PubChem CID | 19377835 |
| Molecular Formula | C14H23Cl2N5O3S |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 4-(4-aminopiperidin-1-yl)-N-(diaminomethylidene)-3-methylsulfonylbenzamide;dihydrochloride |
| SMILES | CS(=O)(=O)c1cc(C(=O)N=C(N)N)ccc1N1CCC(N)CC1.Cl.Cl |
| InChI | InChI=1S/C14H21N5O3S.2ClH/c1-23(21,22)12-8-9(13(20)18-14(16)17)2-3-11(12)19-6-4-10(15)5-7-19;;/h2-3,8,10H,4-7,15H2,1H3,(H4,16,17,18,20);2*1H |
| InChIKey | PMMGNYDRLAVZIG-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 144.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|