About 2,4,5-triethyl-1H-imidazole
2,4,5-triethyl-1H-imidazole (PubChem CID 19377935) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 2,4,5-triethyl-1H-imidazole.
Molecular Properties
| Compound Name | 2,4,5-triethyl-1H-imidazole |
| PubChem CID | 19377935 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 2,4,5-triethyl-1H-imidazole |
| SMILES | CCc1nc(CC)c(CC)[nH]1 |
| InChI | InChI=1S/C9H16N2/c1-4-7-8(5-2)11-9(6-3)10-7/h4-6H2,1-3H3,(H,10,11) |
| InChIKey | CMAMPIMEOWYCDC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4,5-triethyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,5-triethyl-1H-imidazole?
The IUPAC name of 2,4,5-triethyl-1H-imidazole (CID 19377935) is 2,4,5-triethyl-1H-imidazole.
What is the SMILES notation for 2,4,5-triethyl-1H-imidazole?
The canonical SMILES for 2,4,5-triethyl-1H-imidazole is CCc1nc(CC)c(CC)[nH]1.
What is the InChIKey of 2,4,5-triethyl-1H-imidazole?
The InChIKey is CMAMPIMEOWYCDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-4-7-8(5-2)11-9(6-3)10-7/h4-6H2,1-3H3,(H,10,11).
What are the key properties of 2,4,5-triethyl-1H-imidazole?
2,4,5-triethyl-1H-imidazole has a molecular weight of 152.24 g/mol, XLogP of 2.10, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-triethyl-1H-imidazole is sourced from PubChem (CID 19377935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).