C15H19ClF2N2O — CID 19378837
1-[6-(2,4-difluorophenoxy)hexyl]imidazole;hydrochloride (PubChem CID 19378837) has the molecular formula C15H19ClF2N2O and a molecular weight of 316.78 g/mol. Its IUPAC name is 1-[6-(2,4-difluorophenoxy)hexyl]imidazole;hydrochloride.
| Compound Name | 1-[6-(2,4-difluorophenoxy)hexyl]imidazole;hydrochloride |
|---|---|
| PubChem CID | 19378837 |
| Molecular Formula | C15H19ClF2N2O |
| Molecular Weight | 316.78 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1-[6-(2,4-difluorophenoxy)hexyl]imidazole;hydrochloride |
| SMILES | Cl.Fc1ccc(OCCCCCCn2ccnc2)c(F)c1 |
| InChI | InChI=1S/C15H18F2N2O.ClH/c16-13-5-6-15(14(17)11-13)20-10-4-2-1-3-8-19-9-7-18-12-19;/h5-7,9,11-12H,1-4,8,10H2;1H |
| InChIKey | IUYIBZCBCYRNAY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.78 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|