C10H14O3 — CID 19379150
7-methyl-1,3,4,4a,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid (PubChem CID 19379150) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 7-methyl-1,3,4,4a,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid.
| Compound Name | 7-methyl-1,3,4,4a,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid |
|---|---|
| PubChem CID | 19379150 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 7-methyl-1,3,4,4a,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid |
| SMILES | CC1C=CC2C(C(=O)O)COCC12 |
| InChI | InChI=1S/C10H14O3/c1-6-2-3-7-8(6)4-13-5-9(7)10(11)12/h2-3,6-9H,4-5H2,1H3,(H,11,12) |
| InChIKey | GTFVLHHTVRWIGM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|