C26H29F6NO3 — CID 19379320
tert-butyl N-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylhex-5-enyl]carbamate (PubChem CID 19379320) has the molecular formula C26H29F6NO3 and a molecular weight of 517.51 g/mol. Its IUPAC name is tert-butyl N-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylhex-5-enyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylhex-5-enyl]carbamate |
|---|---|
| PubChem CID | 19379320 |
| Molecular Formula | C26H29F6NO3 |
| Molecular Weight | 517.51 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | tert-butyl N-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylhex-5-enyl]carbamate |
| SMILES | C=CCCC(OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(NC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C26H29F6NO3/c1-5-6-12-21(22(18-10-8-7-9-11-18)33-23(34)36-24(2,3)4)35-16-17-13-19(25(27,28)29)15-20(14-17)26(30,31)32/h5,7-11,13-15,21-22H,1,6,12,16H2,2-4H3,(H,33,34) |
| InChIKey | BFMIFZPJTKGXFD-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.51 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|