About 1-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]ethanone
1-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]ethanone (PubChem CID 19379373) has the molecular formula C22H21F6NO2
and a molecular weight of 445.40 g/mol. Its IUPAC name is 1-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]ethanone |
| PubChem CID | 19379373 |
| Molecular Formula | C22H21F6NO2 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 1-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCCC(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1c1ccccc1 |
| InChI | InChI=1S/C22H21F6NO2/c1-14(30)29-9-5-8-19(20(29)16-6-3-2-4-7-16)31-13-15-10-17(21(23,24)25)12-18(11-15)22(26,27)28/h2-4,6-7,10-12,19-20H,5,8-9,13H2,1H3 |
| InChIKey | KNVYPKQUKBUAAW-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]ethanone?
The IUPAC name of 1-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]ethanone (CID 19379373) is 1-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]ethanone.
What is the SMILES notation for 1-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]ethanone?
The canonical SMILES for 1-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]ethanone is CC(=O)N1CCCC(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1c1ccccc1.
What is the InChIKey of 1-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]ethanone?
The InChIKey is KNVYPKQUKBUAAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21F6NO2/c1-14(30)29-9-5-8-19(20(29)16-6-3-2-4-7-16)31-13-15-10-17(21(23,24)25)12-18(11-15)22(26,27)28/h2-4,6-7,10-12,19-20H,5,8-9,13H2,1H3.
What are the key properties of 1-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]ethanone?
1-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]ethanone has a molecular weight of 445.40 g/mol, XLogP of 5.99, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]ethanone is sourced from PubChem (CID 19379373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).