About tert-butyl 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-thiophen-2-ylpiperidine-1-carboxylate
tert-butyl 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-thiophen-2-ylpiperidine-1-carboxylate (PubChem CID 19379397) has the molecular formula C23H25F6NO3S
and a molecular weight of 509.51 g/mol. Its IUPAC name is tert-butyl 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-thiophen-2-ylpiperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-thiophen-2-ylpiperidine-1-carboxylate |
| PubChem CID | 19379397 |
| Molecular Formula | C23H25F6NO3S |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | tert-butyl 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-thiophen-2-ylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1c1cccs1 |
| InChI | InChI=1S/C23H25F6NO3S/c1-21(2,3)33-20(31)30-8-4-6-17(19(30)18-7-5-9-34-18)32-13-14-10-15(22(24,25)26)12-16(11-14)23(27,28)29/h5,7,9-12,17,19H,4,6,8,13H2,1-3H3 |
| InChIKey | QWIZYCODXVLFRH-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-thiophen-2-ylpiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-thiophen-2-ylpiperidine-1-carboxylate?
The IUPAC name of tert-butyl 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-thiophen-2-ylpiperidine-1-carboxylate (CID 19379397) is tert-butyl 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-thiophen-2-ylpiperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-thiophen-2-ylpiperidine-1-carboxylate?
The canonical SMILES for tert-butyl 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-thiophen-2-ylpiperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCCC(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1c1cccs1.
What is the InChIKey of tert-butyl 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-thiophen-2-ylpiperidine-1-carboxylate?
The InChIKey is QWIZYCODXVLFRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25F6NO3S/c1-21(2,3)33-20(31)30-8-4-6-17(19(30)18-7-5-9-34-18)32-13-14-10-15(22(24,25)26)12-16(11-14)23(27,28)29/h5,7,9-12,17,19H,4,6,8,13H2,1-3H3.
What are the key properties of tert-butyl 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-thiophen-2-ylpiperidine-1-carboxylate?
tert-butyl 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-thiophen-2-ylpiperidine-1-carboxylate has a molecular weight of 509.51 g/mol, XLogP of 7.44, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-thiophen-2-ylpiperidine-1-carboxylate is sourced from PubChem (CID 19379397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).