About 5-tri(propan-2-yloxy)silylcyclohex-3-ene-1,2-dicarboxylic acid
5-tri(propan-2-yloxy)silylcyclohex-3-ene-1,2-dicarboxylic acid (PubChem CID 19379540) has the molecular formula C17H30O7Si
and a molecular weight of 374.51 g/mol. Its IUPAC name is 5-tri(propan-2-yloxy)silylcyclohex-3-ene-1,2-dicarboxylic acid.
Molecular Properties
| Compound Name | 5-tri(propan-2-yloxy)silylcyclohex-3-ene-1,2-dicarboxylic acid |
| PubChem CID | 19379540 |
| Molecular Formula | C17H30O7Si |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 5-tri(propan-2-yloxy)silylcyclohex-3-ene-1,2-dicarboxylic acid |
| SMILES | CC(C)O[Si](OC(C)C)(OC(C)C)C1C=CC(C(=O)O)C(C(=O)O)C1 |
| InChI | InChI=1S/C17H30O7Si/c1-10(2)22-25(23-11(3)4,24-12(5)6)13-7-8-14(16(18)19)15(9-13)17(20)21/h7-8,10-15H,9H2,1-6H3,(H,18,19)(H,20,21) |
| InChIKey | MMAJVHNQKODFMY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-tri(propan-2-yloxy)silylcyclohex-3-ene-1,2-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tri(propan-2-yloxy)silylcyclohex-3-ene-1,2-dicarboxylic acid?
The IUPAC name of 5-tri(propan-2-yloxy)silylcyclohex-3-ene-1,2-dicarboxylic acid (CID 19379540) is 5-tri(propan-2-yloxy)silylcyclohex-3-ene-1,2-dicarboxylic acid.
What is the SMILES notation for 5-tri(propan-2-yloxy)silylcyclohex-3-ene-1,2-dicarboxylic acid?
The canonical SMILES for 5-tri(propan-2-yloxy)silylcyclohex-3-ene-1,2-dicarboxylic acid is CC(C)O[Si](OC(C)C)(OC(C)C)C1C=CC(C(=O)O)C(C(=O)O)C1.
What is the InChIKey of 5-tri(propan-2-yloxy)silylcyclohex-3-ene-1,2-dicarboxylic acid?
The InChIKey is MMAJVHNQKODFMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O7Si/c1-10(2)22-25(23-11(3)4,24-12(5)6)13-7-8-14(16(18)19)15(9-13)17(20)21/h7-8,10-15H,9H2,1-6H3,(H,18,19)(H,20,21).
What are the key properties of 5-tri(propan-2-yloxy)silylcyclohex-3-ene-1,2-dicarboxylic acid?
5-tri(propan-2-yloxy)silylcyclohex-3-ene-1,2-dicarboxylic acid has a molecular weight of 374.51 g/mol, XLogP of 2.93, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tri(propan-2-yloxy)silylcyclohex-3-ene-1,2-dicarboxylic acid is sourced from PubChem (CID 19379540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).