About 2-fluorocyclohexa-1,3-dien-1-ol
2-fluorocyclohexa-1,3-dien-1-ol (PubChem CID 19379545) has the molecular formula C6H7FO
and a molecular weight of 114.12 g/mol. Its IUPAC name is 2-fluorocyclohexa-1,3-dien-1-ol.
Molecular Properties
| Compound Name | 2-fluorocyclohexa-1,3-dien-1-ol |
| PubChem CID | 19379545 |
| Molecular Formula | C6H7FO |
| Molecular Weight | 114.12 g/mol |
| Exact Mass | 114.05 |
| IUPAC Name | 2-fluorocyclohexa-1,3-dien-1-ol |
| SMILES | OC1=C(F)C=CCC1 |
| InChI | InChI=1S/C6H7FO/c7-5-3-1-2-4-6(5)8/h1,3,8H,2,4H2 |
| InChIKey | ZBTFTZHOOPLKCV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.12 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-fluorocyclohexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluorocyclohexa-1,3-dien-1-ol?
The IUPAC name of 2-fluorocyclohexa-1,3-dien-1-ol (CID 19379545) is 2-fluorocyclohexa-1,3-dien-1-ol.
What is the SMILES notation for 2-fluorocyclohexa-1,3-dien-1-ol?
The canonical SMILES for 2-fluorocyclohexa-1,3-dien-1-ol is OC1=C(F)C=CCC1.
What is the InChIKey of 2-fluorocyclohexa-1,3-dien-1-ol?
The InChIKey is ZBTFTZHOOPLKCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7FO/c7-5-3-1-2-4-6(5)8/h1,3,8H,2,4H2.
What are the key properties of 2-fluorocyclohexa-1,3-dien-1-ol?
2-fluorocyclohexa-1,3-dien-1-ol has a molecular weight of 114.12 g/mol, XLogP of 2.08, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorocyclohexa-1,3-dien-1-ol is sourced from PubChem (CID 19379545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).