C8H18O3Si — CID 19379547
2,2-dihydroxy-5,5,6,6-tetramethyloxasilinane (PubChem CID 19379547) has the molecular formula C8H18O3Si and a molecular weight of 190.31 g/mol. Its IUPAC name is 2,2-dihydroxy-5,5,6,6-tetramethyloxasilinane.
| Compound Name | 2,2-dihydroxy-5,5,6,6-tetramethyloxasilinane |
|---|---|
| PubChem CID | 19379547 |
| Molecular Formula | C8H18O3Si |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 2,2-dihydroxy-5,5,6,6-tetramethyloxasilinane |
| SMILES | CC1(C)CC[Si](O)(O)OC1(C)C |
| InChI | InChI=1S/C8H18O3Si/c1-7(2)5-6-12(9,10)11-8(7,3)4/h9-10H,5-6H2,1-4H3 |
| InChIKey | DRTUDLVKUDWPQA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|