C8H14N2 — CID 19379788
2,3,3a,4,7,7a-hexahydro-1H-isoindol-1-amine (PubChem CID 19379788) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 2,3,3a,4,7,7a-hexahydro-1H-isoindol-1-amine.
| Compound Name | 2,3,3a,4,7,7a-hexahydro-1H-isoindol-1-amine |
|---|---|
| PubChem CID | 19379788 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 2,3,3a,4,7,7a-hexahydro-1H-isoindol-1-amine |
| SMILES | NC1NCC2CC=CCC21 |
| InChI | InChI=1S/C8H14N2/c9-8-7-4-2-1-3-6(7)5-10-8/h1-2,6-8,10H,3-5,9H2 |
| InChIKey | IVEYBKVSCZYAHU-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|