About 5-butyl-4,6-diazaspiro[2.4]hept-4-en-7-one;hydrochloride
5-butyl-4,6-diazaspiro[2.4]hept-4-en-7-one;hydrochloride (PubChem CID 19379824) has the molecular formula C9H15ClN2O
and a molecular weight of 202.68 g/mol. Its IUPAC name is 5-butyl-4,6-diazaspiro[2.4]hept-4-en-7-one;hydrochloride.
Molecular Properties
| Compound Name | 5-butyl-4,6-diazaspiro[2.4]hept-4-en-7-one;hydrochloride |
| PubChem CID | 19379824 |
| Molecular Formula | C9H15ClN2O |
| Molecular Weight | 202.68 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 5-butyl-4,6-diazaspiro[2.4]hept-4-en-7-one;hydrochloride |
| SMILES | CCCCC1=NC2(CC2)C(=O)N1.Cl |
| InChI | InChI=1S/C9H14N2O.ClH/c1-2-3-4-7-10-8(12)9(11-7)5-6-9;/h2-6H2,1H3,(H,10,11,12);1H |
| InChIKey | ZNLKEDSAPJIQQR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.68 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-butyl-4,6-diazaspiro[2.4]hept-4-en-7-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-4,6-diazaspiro[2.4]hept-4-en-7-one;hydrochloride?
The IUPAC name of 5-butyl-4,6-diazaspiro[2.4]hept-4-en-7-one;hydrochloride (CID 19379824) is 5-butyl-4,6-diazaspiro[2.4]hept-4-en-7-one;hydrochloride.
What is the SMILES notation for 5-butyl-4,6-diazaspiro[2.4]hept-4-en-7-one;hydrochloride?
The canonical SMILES for 5-butyl-4,6-diazaspiro[2.4]hept-4-en-7-one;hydrochloride is CCCCC1=NC2(CC2)C(=O)N1.Cl.
What is the InChIKey of 5-butyl-4,6-diazaspiro[2.4]hept-4-en-7-one;hydrochloride?
The InChIKey is ZNLKEDSAPJIQQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O.ClH/c1-2-3-4-7-10-8(12)9(11-7)5-6-9;/h2-6H2,1H3,(H,10,11,12);1H.
What are the key properties of 5-butyl-4,6-diazaspiro[2.4]hept-4-en-7-one;hydrochloride?
5-butyl-4,6-diazaspiro[2.4]hept-4-en-7-one;hydrochloride has a molecular weight of 202.68 g/mol, XLogP of 1.66, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-4,6-diazaspiro[2.4]hept-4-en-7-one;hydrochloride is sourced from PubChem (CID 19379824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).