C10H17O7P2-3 — CID 19379894
[[(2E)-3,7-dimethylocta-2,6-dienoxy]-oxidophosphoryl] phosphate (PubChem CID 19379894) has the molecular formula C10H17O7P2-3 and a molecular weight of 311.19 g/mol. Its IUPAC name is [[(2E)-3,7-dimethylocta-2,6-dienoxy]-oxidophosphoryl] phosphate.
| Compound Name | [[(2E)-3,7-dimethylocta-2,6-dienoxy]-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 19379894 |
| Molecular Formula | C10H17O7P2-3 |
| Molecular Weight | 311.19 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | [[(2E)-3,7-dimethylocta-2,6-dienoxy]-oxidophosphoryl] phosphate |
| SMILES | CC(C)=CCC/C(C)=C/COP(=O)([O-])OP(=O)([O-])[O-] |
| InChI | InChI=1S/C10H20O7P2/c1-9(2)5-4-6-10(3)7-8-16-19(14,15)17-18(11,12)13/h5,7H,4,6,8H2,1-3H3,(H,14,15)(H2,11,12,13)/p-3/b10-7+ |
| InChIKey | GVVPGTZRZFNKDS-JXMROGBWSA-K |
| XLogP | 1.01 |
| TPSA | 121.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|