About N-(3,4,4-trifluorobut-3-enyl)pyrrolidine-2-carboxamide
N-(3,4,4-trifluorobut-3-enyl)pyrrolidine-2-carboxamide (PubChem CID 19380000) has the molecular formula C9H13F3N2O
and a molecular weight of 222.21 g/mol. Its IUPAC name is N-(3,4,4-trifluorobut-3-enyl)pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | N-(3,4,4-trifluorobut-3-enyl)pyrrolidine-2-carboxamide |
| PubChem CID | 19380000 |
| Molecular Formula | C9H13F3N2O |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | N-(3,4,4-trifluorobut-3-enyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCC(F)=C(F)F)C1CCCN1 |
| InChI | InChI=1S/C9H13F3N2O/c10-6(8(11)12)3-5-14-9(15)7-2-1-4-13-7/h7,13H,1-5H2,(H,14,15) |
| InChIKey | KKOOCUSRKJTUPI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3,4,4-trifluorobut-3-enyl)pyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4,4-trifluorobut-3-enyl)pyrrolidine-2-carboxamide?
The IUPAC name of N-(3,4,4-trifluorobut-3-enyl)pyrrolidine-2-carboxamide (CID 19380000) is N-(3,4,4-trifluorobut-3-enyl)pyrrolidine-2-carboxamide.
What is the SMILES notation for N-(3,4,4-trifluorobut-3-enyl)pyrrolidine-2-carboxamide?
The canonical SMILES for N-(3,4,4-trifluorobut-3-enyl)pyrrolidine-2-carboxamide is O=C(NCCC(F)=C(F)F)C1CCCN1.
What is the InChIKey of N-(3,4,4-trifluorobut-3-enyl)pyrrolidine-2-carboxamide?
The InChIKey is KKOOCUSRKJTUPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3N2O/c10-6(8(11)12)3-5-14-9(15)7-2-1-4-13-7/h7,13H,1-5H2,(H,14,15).
What are the key properties of N-(3,4,4-trifluorobut-3-enyl)pyrrolidine-2-carboxamide?
N-(3,4,4-trifluorobut-3-enyl)pyrrolidine-2-carboxamide has a molecular weight of 222.21 g/mol, XLogP of 1.32, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4,4-trifluorobut-3-enyl)pyrrolidine-2-carboxamide is sourced from PubChem (CID 19380000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).