C44H78N4O8 — CID 19380013
2,3,4-tris(2,2,6,6-tetramethylpiperidin-4-yl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylbutane-1,1,2-tricarboxylic acid (PubChem CID 19380013) has the molecular formula C44H78N4O8 and a molecular weight of 791.13 g/mol. Its IUPAC name is 2,3,4-tris(2,2,6,6-tetramethylpiperidin-4-yl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylbutane-1,1,2-tricarboxylic acid.
| Compound Name | 2,3,4-tris(2,2,6,6-tetramethylpiperidin-4-yl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylbutane-1,1,2-tricarboxylic acid |
|---|---|
| PubChem CID | 19380013 |
| Molecular Formula | C44H78N4O8 |
| Molecular Weight | 791.13 g/mol |
| Exact Mass | 790.58 |
| IUPAC Name | 2,3,4-tris(2,2,6,6-tetramethylpiperidin-4-yl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylbutane-1,1,2-tricarboxylic acid |
| SMILES | CC1(C)CC(CC(C2CC(C)(C)NC(C)(C)C2)C(C(=O)O)(C2CC(C)(C)NC(C)(C)C2)C(C(=O)O)(C(=O)O)C(=O)OC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C44H78N4O8/c1-35(2)18-26(19-36(3,4)45-35)17-30(27-20-37(5,6)46-38(7,8)21-27)43(31(49)50,28-22-39(9,10)47-40(11,12)23-28)44(32(51)52,33(53)54)34(55)56-29-24-41(13,14)48-42(15,16)25-29/h26-30,45-48H,17-25H2,1-16H3,(H,49,50)(H,51,52)(H,53,54) |
| InChIKey | OWUHQLQNVGKYOP-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 186.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.13 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|