About 2-chloro-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride
2-chloro-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride (PubChem CID 19380156) has the molecular formula C8H10Cl2N4
and a molecular weight of 233.10 g/mol. Its IUPAC name is 2-chloro-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 2-chloro-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride |
| PubChem CID | 19380156 |
| Molecular Formula | C8H10Cl2N4 |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 2-chloro-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride |
| SMILES | Cc1cc(C)n2nc(Cl)c(N)c2n1.Cl |
| InChI | InChI=1S/C8H9ClN4.ClH/c1-4-3-5(2)13-8(11-4)6(10)7(9)12-13;/h3H,10H2,1-2H3;1H |
| InChIKey | WTIBWTNWMLAMNR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride?
The IUPAC name of 2-chloro-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride (CID 19380156) is 2-chloro-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride.
What is the SMILES notation for 2-chloro-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride?
The canonical SMILES for 2-chloro-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride is Cc1cc(C)n2nc(Cl)c(N)c2n1.Cl.
What is the InChIKey of 2-chloro-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride?
The InChIKey is WTIBWTNWMLAMNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN4.ClH/c1-4-3-5(2)13-8(11-4)6(10)7(9)12-13;/h3H,10H2,1-2H3;1H.
What are the key properties of 2-chloro-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride?
2-chloro-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride has a molecular weight of 233.10 g/mol, XLogP of 2.00, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride is sourced from PubChem (CID 19380156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).