C17H30O — CID 19380394
1-but-3-enyl-4-(4-methoxycyclohexyl)cyclohexane (PubChem CID 19380394) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is 1-but-3-enyl-4-(4-methoxycyclohexyl)cyclohexane.
| Compound Name | 1-but-3-enyl-4-(4-methoxycyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 19380394 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | 1-but-3-enyl-4-(4-methoxycyclohexyl)cyclohexane |
| SMILES | C=CCCC1CCC(C2CCC(OC)CC2)CC1 |
| InChI | InChI=1S/C17H30O/c1-3-4-5-14-6-8-15(9-7-14)16-10-12-17(18-2)13-11-16/h3,14-17H,1,4-13H2,2H3 |
| InChIKey | WYBZATIXHWNADB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|