C27H33ClN2O3 — CID 19380972
N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2,2-diethoxyacetamide (PubChem CID 19380972) has the molecular formula C27H33ClN2O3 and a molecular weight of 469.03 g/mol. Its IUPAC name is N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2,2-diethoxyacetamide.
| Compound Name | N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2,2-diethoxyacetamide |
|---|---|
| PubChem CID | 19380972 |
| Molecular Formula | C27H33ClN2O3 |
| Molecular Weight | 469.03 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2,2-diethoxyacetamide |
| SMILES | CCOC(OCC)C(=O)NC1CCN(CC23CC(c4ccccc42)c2ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C27H33ClN2O3/c1-3-32-26(33-4-2)25(31)29-19-11-13-30(14-12-19)17-27-16-22(20-7-5-6-8-23(20)27)21-10-9-18(28)15-24(21)27/h5-10,15,19,22,26H,3-4,11-14,16-17H2,1-2H3,(H,29,31) |
| InChIKey | DOWHWGWRLJFPKD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.03 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|