C25H29ClN2O2 — CID 19381000
N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2-ethoxyacetamide (PubChem CID 19381000) has the molecular formula C25H29ClN2O2 and a molecular weight of 424.97 g/mol. Its IUPAC name is N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2-ethoxyacetamide.
| Compound Name | N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2-ethoxyacetamide |
|---|---|
| PubChem CID | 19381000 |
| Molecular Formula | C25H29ClN2O2 |
| Molecular Weight | 424.97 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2-ethoxyacetamide |
| SMILES | CCOCC(=O)NC1CCN(CC23CC(c4ccccc42)c2ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C25H29ClN2O2/c1-2-30-15-24(29)27-18-9-11-28(12-10-18)16-25-14-21(19-5-3-4-6-22(19)25)20-8-7-17(26)13-23(20)25/h3-8,13,18,21H,2,9-12,14-16H2,1H3,(H,27,29) |
| InChIKey | DCGVKDWKDRCUGP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.97 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |