C26H31ClN2O — CID 19381009
N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2,2-dimethylpropanamide (PubChem CID 19381009) has the molecular formula C26H31ClN2O and a molecular weight of 423.00 g/mol. Its IUPAC name is N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 19381009 |
| Molecular Formula | C26H31ClN2O |
| Molecular Weight | 423.00 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NC1CCN(CC23CC(c4ccccc42)c2ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C26H31ClN2O/c1-25(2,3)24(30)28-18-10-12-29(13-11-18)16-26-15-21(19-6-4-5-7-22(19)26)20-9-8-17(27)14-23(20)26/h4-9,14,18,21H,10-13,15-16H2,1-3H3,(H,28,30) |
| InChIKey | CEMGSMJPVGFUSR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.00 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |