C29H35ClN2O2 — CID 19381057
N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2-cyclopentyl-2-methoxyacetamide (PubChem CID 19381057) has the molecular formula C29H35ClN2O2 and a molecular weight of 479.06 g/mol. Its IUPAC name is N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2-cyclopentyl-2-methoxyacetamide.
| Compound Name | N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2-cyclopentyl-2-methoxyacetamide |
|---|---|
| PubChem CID | 19381057 |
| Molecular Formula | C29H35ClN2O2 |
| Molecular Weight | 479.06 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2-cyclopentyl-2-methoxyacetamide |
| SMILES | COC(C(=O)NC1CCN(CC23CC(c4ccccc42)c2ccc(Cl)cc23)CC1)C1CCCC1 |
| InChI | InChI=1S/C29H35ClN2O2/c1-34-27(19-6-2-3-7-19)28(33)31-21-12-14-32(15-13-21)18-29-17-24(22-8-4-5-9-25(22)29)23-11-10-20(30)16-26(23)29/h4-5,8-11,16,19,21,24,27H,2-3,6-7,12-15,17-18H2,1H3,(H,31,33) |
| InChIKey | FPPFSLVWEBBXNU-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.06 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |