About trimethyl-(3-methylidene-5-trimethylsilylpenta-1,4-diynyl)silane
trimethyl-(3-methylidene-5-trimethylsilylpenta-1,4-diynyl)silane (PubChem CID 19381117) has the molecular formula C12H20Si2
and a molecular weight of 220.46 g/mol. Its IUPAC name is trimethyl-(3-methylidene-5-trimethylsilylpenta-1,4-diynyl)silane.
Molecular Properties
| Compound Name | trimethyl-(3-methylidene-5-trimethylsilylpenta-1,4-diynyl)silane |
| PubChem CID | 19381117 |
| Molecular Formula | C12H20Si2 |
| Molecular Weight | 220.46 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | trimethyl-(3-methylidene-5-trimethylsilylpenta-1,4-diynyl)silane |
| SMILES | C=C(C#C[Si](C)(C)C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C12H20Si2/c1-12(8-10-13(2,3)4)9-11-14(5,6)7/h1H2,2-7H3 |
| InChIKey | JEYJNYREFBGUOB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-(3-methylidene-5-trimethylsilylpenta-1,4-diynyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-(3-methylidene-5-trimethylsilylpenta-1,4-diynyl)silane?
The IUPAC name of trimethyl-(3-methylidene-5-trimethylsilylpenta-1,4-diynyl)silane (CID 19381117) is trimethyl-(3-methylidene-5-trimethylsilylpenta-1,4-diynyl)silane.
What is the SMILES notation for trimethyl-(3-methylidene-5-trimethylsilylpenta-1,4-diynyl)silane?
The canonical SMILES for trimethyl-(3-methylidene-5-trimethylsilylpenta-1,4-diynyl)silane is C=C(C#C[Si](C)(C)C)C#C[Si](C)(C)C.
What is the InChIKey of trimethyl-(3-methylidene-5-trimethylsilylpenta-1,4-diynyl)silane?
The InChIKey is JEYJNYREFBGUOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20Si2/c1-12(8-10-13(2,3)4)9-11-14(5,6)7/h1H2,2-7H3.
What are the key properties of trimethyl-(3-methylidene-5-trimethylsilylpenta-1,4-diynyl)silane?
trimethyl-(3-methylidene-5-trimethylsilylpenta-1,4-diynyl)silane has a molecular weight of 220.46 g/mol, XLogP of 3.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-(3-methylidene-5-trimethylsilylpenta-1,4-diynyl)silane is sourced from PubChem (CID 19381117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).