About 8-bromo-6-ethylquinoline
8-bromo-6-ethylquinoline (PubChem CID 19381206) has the molecular formula C11H10BrN
and a molecular weight of 236.11 g/mol. Its IUPAC name is 8-bromo-6-ethylquinoline.
Molecular Properties
| Compound Name | 8-bromo-6-ethylquinoline |
| PubChem CID | 19381206 |
| Molecular Formula | C11H10BrN |
| Molecular Weight | 236.11 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | 8-bromo-6-ethylquinoline |
| SMILES | CCc1cc(Br)c2ncccc2c1 |
| InChI | InChI=1S/C11H10BrN/c1-2-8-6-9-4-3-5-13-11(9)10(12)7-8/h3-7H,2H2,1H3 |
| InChIKey | AATYYFKHRSKUTP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.11 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-bromo-6-ethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-6-ethylquinoline?
The IUPAC name of 8-bromo-6-ethylquinoline (CID 19381206) is 8-bromo-6-ethylquinoline.
What is the SMILES notation for 8-bromo-6-ethylquinoline?
The canonical SMILES for 8-bromo-6-ethylquinoline is CCc1cc(Br)c2ncccc2c1.
What is the InChIKey of 8-bromo-6-ethylquinoline?
The InChIKey is AATYYFKHRSKUTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrN/c1-2-8-6-9-4-3-5-13-11(9)10(12)7-8/h3-7H,2H2,1H3.
What are the key properties of 8-bromo-6-ethylquinoline?
8-bromo-6-ethylquinoline has a molecular weight of 236.11 g/mol, XLogP of 3.56, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-6-ethylquinoline is sourced from PubChem (CID 19381206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).