C26H35ClN2O2 — CID 19381392
4-chloro-N-[4-[4-[(4-hydroxybutylamino)methyl]phenyl]cyclohexyl]-N,3-dimethylbenzamide (PubChem CID 19381392) has the molecular formula C26H35ClN2O2 and a molecular weight of 443.03 g/mol. Its IUPAC name is 4-chloro-N-[4-[4-[(4-hydroxybutylamino)methyl]phenyl]cyclohexyl]-N,3-dimethylbenzamide.
| Compound Name | 4-chloro-N-[4-[4-[(4-hydroxybutylamino)methyl]phenyl]cyclohexyl]-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 19381392 |
| Molecular Formula | C26H35ClN2O2 |
| Molecular Weight | 443.03 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 4-chloro-N-[4-[4-[(4-hydroxybutylamino)methyl]phenyl]cyclohexyl]-N,3-dimethylbenzamide |
| SMILES | Cc1cc(C(=O)N(C)C2CCC(c3ccc(CNCCCCO)cc3)CC2)ccc1Cl |
| InChI | InChI=1S/C26H35ClN2O2/c1-19-17-23(11-14-25(19)27)26(31)29(2)24-12-9-22(10-13-24)21-7-5-20(6-8-21)18-28-15-3-4-16-30/h5-8,11,14,17,22,24,28,30H,3-4,9-10,12-13,15-16,18H2,1-2H3 |
| InChIKey | BOWORHIWCKZWMJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.03 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|