About 1,4,7-triazaspiro[4.4]nonane
1,4,7-triazaspiro[4.4]nonane (PubChem CID 19382236) has the molecular formula C6H13N3
and a molecular weight of 127.19 g/mol. Its IUPAC name is 1,4,7-triazaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 1,4,7-triazaspiro[4.4]nonane |
| PubChem CID | 19382236 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | 1,4,7-triazaspiro[4.4]nonane |
| SMILES | C1CC2(CN1)NCCN2 |
| InChI | InChI=1S/C6H13N3/c1-2-7-5-6(1)8-3-4-9-6/h7-9H,1-5H2 |
| InChIKey | HDJOKHYRFMHGOJ-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,4,7-triazaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4,7-triazaspiro[4.4]nonane?
The IUPAC name of 1,4,7-triazaspiro[4.4]nonane (CID 19382236) is 1,4,7-triazaspiro[4.4]nonane.
What is the SMILES notation for 1,4,7-triazaspiro[4.4]nonane?
The canonical SMILES for 1,4,7-triazaspiro[4.4]nonane is C1CC2(CN1)NCCN2.
What is the InChIKey of 1,4,7-triazaspiro[4.4]nonane?
The InChIKey is HDJOKHYRFMHGOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3/c1-2-7-5-6(1)8-3-4-9-6/h7-9H,1-5H2.
What are the key properties of 1,4,7-triazaspiro[4.4]nonane?
1,4,7-triazaspiro[4.4]nonane has a molecular weight of 127.19 g/mol, XLogP of -1.13, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4,7-triazaspiro[4.4]nonane is sourced from PubChem (CID 19382236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).