piperidine-2-carboxamide;2,2,2-trifluoroacetic acid

C8H13F3N2O3 — CID 19382392

IUPACpiperidine-2-carboxamide;2,2,2-trifluoroacetic acid
SMILESNC(=O)C1CCCCN1.O=C(O)C(F)(F)F
InChIInChI=1S/C6H12N2O.C2HF3O2/c7-6(9)5-3-1-2-4-8-5;3-2(4,5)1(6)7/h5,8H,1-4H2,(H2,7,9);(H,6,7)
InChIKeyWQVWALXZNOFRRY-UHFFFAOYSA-N
MW242.20 g/mol
LogP0.25
Rot. Bonds1

About piperidine-2-carboxamide;2,2,2-trifluoroacetic acid

piperidine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 19382392) has the molecular formula C8H13F3N2O3 and a molecular weight of 242.20 g/mol. Its IUPAC name is piperidine-2-carboxamide;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Namepiperidine-2-carboxamide;2,2,2-trifluoroacetic acid
PubChem CID19382392
Molecular FormulaC8H13F3N2O3
Molecular Weight242.20 g/mol
Exact Mass242.09
IUPAC Namepiperidine-2-carboxamide;2,2,2-trifluoroacetic acid
SMILESNC(=O)C1CCCCN1.O=C(O)C(F)(F)F
InChIInChI=1S/C6H12N2O.C2HF3O2/c7-6(9)5-3-1-2-4-8-5;3-2(4,5)1(6)7/h5,8H,1-4H2,(H2,7,9);(H,6,7)
InChIKeyWQVWALXZNOFRRY-UHFFFAOYSA-N
XLogP0.25
TPSA92.42 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.20
LogP ≤ 50.25
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze piperidine-2-carboxamide;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of piperidine-2-carboxamide;2,2,2-trifluoroacetic acid?
The IUPAC name of piperidine-2-carboxamide;2,2,2-trifluoroacetic acid (CID 19382392) is piperidine-2-carboxamide;2,2,2-trifluoroacetic acid.
What is the SMILES notation for piperidine-2-carboxamide;2,2,2-trifluoroacetic acid?
The canonical SMILES for piperidine-2-carboxamide;2,2,2-trifluoroacetic acid is NC(=O)C1CCCCN1.O=C(O)C(F)(F)F.
What is the InChIKey of piperidine-2-carboxamide;2,2,2-trifluoroacetic acid?
The InChIKey is WQVWALXZNOFRRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.C2HF3O2/c7-6(9)5-3-1-2-4-8-5;3-2(4,5)1(6)7/h5,8H,1-4H2,(H2,7,9);(H,6,7).
What are the key properties of piperidine-2-carboxamide;2,2,2-trifluoroacetic acid?
piperidine-2-carboxamide;2,2,2-trifluoroacetic acid has a molecular weight of 242.20 g/mol, XLogP of 0.25, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine-2-carboxamide;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 19382392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).