C37H38N4O4S — CID 19382398
2-[(3-methyl-1,2,3,4-tetrahydroquinolin-8-yl)sulfonylamino]-5-(1-tritylimidazol-4-yl)pentanoic acid (PubChem CID 19382398) has the molecular formula C37H38N4O4S and a molecular weight of 634.80 g/mol. Its IUPAC name is 2-[(3-methyl-1,2,3,4-tetrahydroquinolin-8-yl)sulfonylamino]-5-(1-tritylimidazol-4-yl)pentanoic acid.
| Compound Name | 2-[(3-methyl-1,2,3,4-tetrahydroquinolin-8-yl)sulfonylamino]-5-(1-tritylimidazol-4-yl)pentanoic acid |
|---|---|
| PubChem CID | 19382398 |
| Molecular Formula | C37H38N4O4S |
| Molecular Weight | 634.80 g/mol |
| Exact Mass | 634.26 |
| IUPAC Name | 2-[(3-methyl-1,2,3,4-tetrahydroquinolin-8-yl)sulfonylamino]-5-(1-tritylimidazol-4-yl)pentanoic acid |
| SMILES | CC1CNc2c(cccc2S(=O)(=O)NC(CCCc2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)C(=O)O)C1 |
| InChI | InChI=1S/C37H38N4O4S/c1-27-23-28-13-11-22-34(35(28)38-24-27)46(44,45)40-33(36(42)43)21-12-20-32-25-41(26-39-32)37(29-14-5-2-6-15-29,30-16-7-3-8-17-30)31-18-9-4-10-19-31/h2-11,13-19,22,25-27,33,38,40H,12,20-21,23-24H2,1H3,(H,42,43) |
| InChIKey | XZHZPKUTQFGEMJ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.80 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|