C31H31F5O5S — CID 19382484
3-[1-[4-[3-[4-(2,2,3,3,3-pentafluoropropanoyl)phenoxy]propoxy]phenyl]-4-phenylbutyl]sulfanylpropanoic acid (PubChem CID 19382484) has the molecular formula C31H31F5O5S and a molecular weight of 610.64 g/mol. Its IUPAC name is 3-[1-[4-[3-[4-(2,2,3,3,3-pentafluoropropanoyl)phenoxy]propoxy]phenyl]-4-phenylbutyl]sulfanylpropanoic acid.
| Compound Name | 3-[1-[4-[3-[4-(2,2,3,3,3-pentafluoropropanoyl)phenoxy]propoxy]phenyl]-4-phenylbutyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 19382484 |
| Molecular Formula | C31H31F5O5S |
| Molecular Weight | 610.64 g/mol |
| Exact Mass | 610.18 |
| IUPAC Name | 3-[1-[4-[3-[4-(2,2,3,3,3-pentafluoropropanoyl)phenoxy]propoxy]phenyl]-4-phenylbutyl]sulfanylpropanoic acid |
| SMILES | O=C(O)CCSC(CCCc1ccccc1)c1ccc(OCCCOc2ccc(C(=O)C(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C31H31F5O5S/c32-30(33,31(34,35)36)29(39)24-12-16-26(17-13-24)41-20-5-19-40-25-14-10-23(11-15-25)27(42-21-18-28(37)38)9-4-8-22-6-2-1-3-7-22/h1-3,6-7,10-17,27H,4-5,8-9,18-21H2,(H,37,38) |
| InChIKey | IYLLRFKXVKLKPI-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.64 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|