C35H41F3O6S — CID 19382499
3-[1-[4-[2-pentoxy-3-[4-(2,2,2-trifluoroacetyl)phenoxy]propoxy]phenyl]-4-phenylbutyl]sulfanylpropanoic acid (PubChem CID 19382499) has the molecular formula C35H41F3O6S and a molecular weight of 646.77 g/mol. Its IUPAC name is 3-[1-[4-[2-pentoxy-3-[4-(2,2,2-trifluoroacetyl)phenoxy]propoxy]phenyl]-4-phenylbutyl]sulfanylpropanoic acid.
| Compound Name | 3-[1-[4-[2-pentoxy-3-[4-(2,2,2-trifluoroacetyl)phenoxy]propoxy]phenyl]-4-phenylbutyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 19382499 |
| Molecular Formula | C35H41F3O6S |
| Molecular Weight | 646.77 g/mol |
| Exact Mass | 646.26 |
| IUPAC Name | 3-[1-[4-[2-pentoxy-3-[4-(2,2,2-trifluoroacetyl)phenoxy]propoxy]phenyl]-4-phenylbutyl]sulfanylpropanoic acid |
| SMILES | CCCCCOC(COc1ccc(C(=O)C(F)(F)F)cc1)COc1ccc(C(CCCc2ccccc2)SCCC(=O)O)cc1 |
| InChI | InChI=1S/C35H41F3O6S/c1-2-3-7-22-42-31(25-44-30-19-15-28(16-20-30)34(41)35(36,37)38)24-43-29-17-13-27(14-18-29)32(45-23-21-33(39)40)12-8-11-26-9-5-4-6-10-26/h4-6,9-10,13-20,31-32H,2-3,7-8,11-12,21-25H2,1H3,(H,39,40) |
| InChIKey | NRZYFOYOMFFSES-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.77 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|