C30H31F3O4S2 — CID 19382514
3-[4-phenyl-1-[4-[3-[4-(2,2,2-trifluoroacetyl)phenyl]sulfanylpropoxy]phenyl]butyl]sulfanylpropanoic acid (PubChem CID 19382514) has the molecular formula C30H31F3O4S2 and a molecular weight of 576.70 g/mol. Its IUPAC name is 3-[4-phenyl-1-[4-[3-[4-(2,2,2-trifluoroacetyl)phenyl]sulfanylpropoxy]phenyl]butyl]sulfanylpropanoic acid.
| Compound Name | 3-[4-phenyl-1-[4-[3-[4-(2,2,2-trifluoroacetyl)phenyl]sulfanylpropoxy]phenyl]butyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 19382514 |
| Molecular Formula | C30H31F3O4S2 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | 3-[4-phenyl-1-[4-[3-[4-(2,2,2-trifluoroacetyl)phenyl]sulfanylpropoxy]phenyl]butyl]sulfanylpropanoic acid |
| SMILES | O=C(O)CCSC(CCCc1ccccc1)c1ccc(OCCCSc2ccc(C(=O)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C30H31F3O4S2/c31-30(32,33)29(36)24-12-16-26(17-13-24)38-20-5-19-37-25-14-10-23(11-15-25)27(39-21-18-28(34)35)9-4-8-22-6-2-1-3-7-22/h1-3,6-7,10-17,27H,4-5,8-9,18-21H2,(H,34,35) |
| InChIKey | ALCHQMAJMWOWLU-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|