About 4-(3-methoxypropyl)-3,5-dimethyl-1H-pyrazole;hydrochloride
4-(3-methoxypropyl)-3,5-dimethyl-1H-pyrazole;hydrochloride (PubChem CID 19382660) has the molecular formula C9H17ClN2O
and a molecular weight of 204.70 g/mol. Its IUPAC name is 4-(3-methoxypropyl)-3,5-dimethyl-1H-pyrazole;hydrochloride.
Molecular Properties
| Compound Name | 4-(3-methoxypropyl)-3,5-dimethyl-1H-pyrazole;hydrochloride |
| PubChem CID | 19382660 |
| Molecular Formula | C9H17ClN2O |
| Molecular Weight | 204.70 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 4-(3-methoxypropyl)-3,5-dimethyl-1H-pyrazole;hydrochloride |
| SMILES | COCCCc1c(C)n[nH]c1C.Cl |
| InChI | InChI=1S/C9H16N2O.ClH/c1-7-9(5-4-6-12-3)8(2)11-10-7;/h4-6H2,1-3H3,(H,10,11);1H |
| InChIKey | DPYACVIAPUAMEA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.70 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-methoxypropyl)-3,5-dimethyl-1H-pyrazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methoxypropyl)-3,5-dimethyl-1H-pyrazole;hydrochloride?
The IUPAC name of 4-(3-methoxypropyl)-3,5-dimethyl-1H-pyrazole;hydrochloride (CID 19382660) is 4-(3-methoxypropyl)-3,5-dimethyl-1H-pyrazole;hydrochloride.
What is the SMILES notation for 4-(3-methoxypropyl)-3,5-dimethyl-1H-pyrazole;hydrochloride?
The canonical SMILES for 4-(3-methoxypropyl)-3,5-dimethyl-1H-pyrazole;hydrochloride is COCCCc1c(C)n[nH]c1C.Cl.
What is the InChIKey of 4-(3-methoxypropyl)-3,5-dimethyl-1H-pyrazole;hydrochloride?
The InChIKey is DPYACVIAPUAMEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O.ClH/c1-7-9(5-4-6-12-3)8(2)11-10-7;/h4-6H2,1-3H3,(H,10,11);1H.
What are the key properties of 4-(3-methoxypropyl)-3,5-dimethyl-1H-pyrazole;hydrochloride?
4-(3-methoxypropyl)-3,5-dimethyl-1H-pyrazole;hydrochloride has a molecular weight of 204.70 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methoxypropyl)-3,5-dimethyl-1H-pyrazole;hydrochloride is sourced from PubChem (CID 19382660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).