C36H41NO10S2 — CID 19382798
3-[3-[2-(3,4-dimethoxyphenyl)-1,1,3,3-tetraoxo-1,3-dithian-2-yl]propyl-methylamino]propyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate (PubChem CID 19382798) has the molecular formula C36H41NO10S2 and a molecular weight of 711.86 g/mol. Its IUPAC name is 3-[3-[2-(3,4-dimethoxyphenyl)-1,1,3,3-tetraoxo-1,3-dithian-2-yl]propyl-methylamino]propyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate.
| Compound Name | 3-[3-[2-(3,4-dimethoxyphenyl)-1,1,3,3-tetraoxo-1,3-dithian-2-yl]propyl-methylamino]propyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate |
|---|---|
| PubChem CID | 19382798 |
| Molecular Formula | C36H41NO10S2 |
| Molecular Weight | 711.86 g/mol |
| Exact Mass | 711.22 |
| IUPAC Name | 3-[3-[2-(3,4-dimethoxyphenyl)-1,1,3,3-tetraoxo-1,3-dithian-2-yl]propyl-methylamino]propyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate |
| SMILES | COc1ccc(C2(CCCN(C)CCCOC(=O)c3cccc4c(=O)c(C)c(-c5ccccc5)oc34)S(=O)(=O)CCCS2(=O)=O)cc1OC |
| InChI | InChI=1S/C36H41NO10S2/c1-25-32(38)28-14-8-15-29(34(28)47-33(25)26-12-6-5-7-13-26)35(39)46-21-10-20-37(2)19-9-18-36(48(40,41)22-11-23-49(36,42)43)27-16-17-30(44-3)31(24-27)45-4/h5-8,12-17,24H,9-11,18-23H2,1-4H3 |
| InChIKey | DIQRMJAKCAJGDG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 146.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.86 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|