C13H15NO — CID 19384572
5-methyl-6,7,8,9-tetrahydro-5H-carbazol-2-ol (PubChem CID 19384572) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 5-methyl-6,7,8,9-tetrahydro-5H-carbazol-2-ol.
| Compound Name | 5-methyl-6,7,8,9-tetrahydro-5H-carbazol-2-ol |
|---|---|
| PubChem CID | 19384572 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 5-methyl-6,7,8,9-tetrahydro-5H-carbazol-2-ol |
| SMILES | CC1CCCc2[nH]c3cc(O)ccc3c21 |
| InChI | InChI=1S/C13H15NO/c1-8-3-2-4-11-13(8)10-6-5-9(15)7-12(10)14-11/h5-8,14-15H,2-4H2,1H3 |
| InChIKey | SMYTZUVTPHZRJI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|