About 5-octyl-4H-carbazole
5-octyl-4H-carbazole (PubChem CID 19384583) has the molecular formula C20H25N
and a molecular weight of 279.43 g/mol. Its IUPAC name is 5-octyl-4H-carbazole.
Molecular Properties
| Compound Name | 5-octyl-4H-carbazole |
| PubChem CID | 19384583 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 5-octyl-4H-carbazole |
| SMILES | CCCCCCCCc1cccc2c1=C1CC=CC=C1N=2 |
| InChI | InChI=1S/C20H25N/c1-2-3-4-5-6-7-11-16-12-10-15-19-20(16)17-13-8-9-14-18(17)21-19/h8-10,12,14-15H,2-7,11,13H2,1H3 |
| InChIKey | BNSOAXPJERBARD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-octyl-4H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-octyl-4H-carbazole?
The IUPAC name of 5-octyl-4H-carbazole (CID 19384583) is 5-octyl-4H-carbazole.
What is the SMILES notation for 5-octyl-4H-carbazole?
The canonical SMILES for 5-octyl-4H-carbazole is CCCCCCCCc1cccc2c1=C1CC=CC=C1N=2.
What is the InChIKey of 5-octyl-4H-carbazole?
The InChIKey is BNSOAXPJERBARD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N/c1-2-3-4-5-6-7-11-16-12-10-15-19-20(16)17-13-8-9-14-18(17)21-19/h8-10,12,14-15H,2-7,11,13H2,1H3.
What are the key properties of 5-octyl-4H-carbazole?
5-octyl-4H-carbazole has a molecular weight of 279.43 g/mol, XLogP of 4.22, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-octyl-4H-carbazole is sourced from PubChem (CID 19384583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).