C10H9F13N2O2S — CID 19384750
1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)piperazine (PubChem CID 19384750) has the molecular formula C10H9F13N2O2S and a molecular weight of 468.24 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)piperazine.
| Compound Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)piperazine |
|---|---|
| PubChem CID | 19384750 |
| Molecular Formula | C10H9F13N2O2S |
| Molecular Weight | 468.24 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)piperazine |
| SMILES | O=S(=O)(N1CCNCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H9F13N2O2S/c11-5(12,7(15,16)9(19,20)21)6(13,14)8(17,18)10(22,23)28(26,27)25-3-1-24-2-4-25/h24H,1-4H2 |
| InChIKey | ZIUJJLGCNPNGBX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|