About (2,2,5-trimethyl-1,3-dioxan-5-yl)methyl carbonochloridate
(2,2,5-trimethyl-1,3-dioxan-5-yl)methyl carbonochloridate (PubChem CID 19384829) has the molecular formula C9H15ClO4
and a molecular weight of 222.67 g/mol. Its IUPAC name is (2,2,5-trimethyl-1,3-dioxan-5-yl)methyl carbonochloridate.
Molecular Properties
| Compound Name | (2,2,5-trimethyl-1,3-dioxan-5-yl)methyl carbonochloridate |
| PubChem CID | 19384829 |
| Molecular Formula | C9H15ClO4 |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | (2,2,5-trimethyl-1,3-dioxan-5-yl)methyl carbonochloridate |
| SMILES | CC1(COC(=O)Cl)COC(C)(C)OC1 |
| InChI | InChI=1S/C9H15ClO4/c1-8(2)13-5-9(3,6-14-8)4-12-7(10)11/h4-6H2,1-3H3 |
| InChIKey | NFDRDEYTZQWRDI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze (2,2,5-trimethyl-1,3-dioxan-5-yl)methyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2,5-trimethyl-1,3-dioxan-5-yl)methyl carbonochloridate?
The IUPAC name of (2,2,5-trimethyl-1,3-dioxan-5-yl)methyl carbonochloridate (CID 19384829) is (2,2,5-trimethyl-1,3-dioxan-5-yl)methyl carbonochloridate.
What is the SMILES notation for (2,2,5-trimethyl-1,3-dioxan-5-yl)methyl carbonochloridate?
The canonical SMILES for (2,2,5-trimethyl-1,3-dioxan-5-yl)methyl carbonochloridate is CC1(COC(=O)Cl)COC(C)(C)OC1.
What is the InChIKey of (2,2,5-trimethyl-1,3-dioxan-5-yl)methyl carbonochloridate?
The InChIKey is NFDRDEYTZQWRDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15ClO4/c1-8(2)13-5-9(3,6-14-8)4-12-7(10)11/h4-6H2,1-3H3.
What are the key properties of (2,2,5-trimethyl-1,3-dioxan-5-yl)methyl carbonochloridate?
(2,2,5-trimethyl-1,3-dioxan-5-yl)methyl carbonochloridate has a molecular weight of 222.67 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2,5-trimethyl-1,3-dioxan-5-yl)methyl carbonochloridate is sourced from PubChem (CID 19384829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).